C18H18BrClO — CID 106893992
2-[(3-bromo-4-ethoxyphenyl)-chloromethyl]-2,3-dihydro-1H-indene (PubChem CID 106893992) has the molecular formula C18H18BrClO and a molecular weight of 365.70 g/mol. Its IUPAC name is 2-[(3-bromo-4-ethoxyphenyl)-chloromethyl]-2,3-dihydro-1H-indene.
| Compound Name | 2-[(3-bromo-4-ethoxyphenyl)-chloromethyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 106893992 |
| Molecular Formula | C18H18BrClO |
| Molecular Weight | 365.70 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-[(3-bromo-4-ethoxyphenyl)-chloromethyl]-2,3-dihydro-1H-indene |
| SMILES | CCOc1ccc(C(Cl)C2Cc3ccccc3C2)cc1Br |
| InChI | InChI=1S/C18H18BrClO/c1-2-21-17-8-7-14(11-16(17)19)18(20)15-9-12-5-3-4-6-13(12)10-15/h3-8,11,15,18H,2,9-10H2,1H3 |
| InChIKey | AFXUXLNWJUTVBH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|