C17H28N4O2 — CID 106895074
tert-butyl 2-[2-(pyridazin-3-ylmethylamino)propyl]pyrrolidine-1-carboxylate (PubChem CID 106895074) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl 2-[2-(pyridazin-3-ylmethylamino)propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(pyridazin-3-ylmethylamino)propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106895074 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl 2-[2-(pyridazin-3-ylmethylamino)propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(CC1CCCN1C(=O)OC(C)(C)C)NCc1cccnn1 |
| InChI | InChI=1S/C17H28N4O2/c1-13(18-12-14-7-5-9-19-20-14)11-15-8-6-10-21(15)16(22)23-17(2,3)4/h5,7,9,13,15,18H,6,8,10-12H2,1-4H3 |
| InChIKey | APCGVIKOGBIMHT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |