C10H10N4O3S — CID 106897421
6-oxo-N-(pyridazin-3-ylmethyl)-1H-pyridine-3-sulfonamide (PubChem CID 106897421) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is 6-oxo-N-(pyridazin-3-ylmethyl)-1H-pyridine-3-sulfonamide.
| Compound Name | 6-oxo-N-(pyridazin-3-ylmethyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106897421 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 6-oxo-N-(pyridazin-3-ylmethyl)-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCc2cccnn2)c[nH]1 |
| InChI | InChI=1S/C10H10N4O3S/c15-10-4-3-9(7-11-10)18(16,17)13-6-8-2-1-5-12-14-8/h1-5,7,13H,6H2,(H,11,15) |
| InChIKey | BZOPSHXSIBRTFW-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |