C20H24O6 — CID 10689866
(1R,5S,7Z,11S,13S,14S)-13-hydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.12,5]heptadeca-2(17),7-diene-3,9,12-trione (PubChem CID 10689866) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1R,5S,7Z,11S,13S,14S)-13-hydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.12,5]heptadeca-2(17),7-diene-3,9,12-trione.
| Compound Name | (1R,5S,7Z,11S,13S,14S)-13-hydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.12,5]heptadeca-2(17),7-diene-3,9,12-trione |
|---|---|
| PubChem CID | 10689866 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1R,5S,7Z,11S,13S,14S)-13-hydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.12,5]heptadeca-2(17),7-diene-3,9,12-trione |
| SMILES | C=C(C)[C@@H]1C[C@H]2O[C@]1(O)C(=O)[C@@H](C)CC(=O)/C=C(/C)C[C@H]1C=C2C(=O)O1 |
| InChI | InChI=1S/C20H24O6/c1-10(2)16-9-17-15-8-14(25-19(15)23)6-11(3)5-13(21)7-12(4)18(22)20(16,24)26-17/h5,8,12,14,16-17,24H,1,6-7,9H2,2-4H3/b11-5-/t12-,14-,16-,17+,20-/m0/s1 |
| InChIKey | LJQPUSXPSUZLOQ-UBOZWUAPSA-N |
| XLogP | 2.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|