C25H31NO — CID 10689969
(1S)-1-naphthalen-2-yl-N-[(1S)-1-phenylbutoxy]pentan-1-amine (PubChem CID 10689969) has the molecular formula C25H31NO and a molecular weight of 361.53 g/mol. Its IUPAC name is (1S)-1-naphthalen-2-yl-N-[(1S)-1-phenylbutoxy]pentan-1-amine.
| Compound Name | (1S)-1-naphthalen-2-yl-N-[(1S)-1-phenylbutoxy]pentan-1-amine |
|---|---|
| PubChem CID | 10689969 |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (1S)-1-naphthalen-2-yl-N-[(1S)-1-phenylbutoxy]pentan-1-amine |
| SMILES | CCCC[C@H](NO[C@@H](CCC)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H31NO/c1-3-5-16-24(23-18-17-20-12-9-10-15-22(20)19-23)26-27-25(11-4-2)21-13-7-6-8-14-21/h6-10,12-15,17-19,24-26H,3-5,11,16H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | CPMDJVZVQGJFKY-DQEYMECFSA-N |
| XLogP | 7.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|