About N-Benzoxybenzhydrylamine
N-Benzoxybenzhydrylamine (PubChem CID 15025165) has the molecular formula C20H19NO
and a molecular weight of 289.40 g/mol. Its IUPAC name is 1,1-diphenyl-N-phenylmethoxymethanamine.
Molecular Properties
| Compound Name | N-Benzoxybenzhydrylamine |
| PubChem CID | 15025165 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1,1-diphenyl-N-phenylmethoxymethanamine |
| SMILES | C1=CC=C(C=C1)CONC(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | InChI=1S/C20H19NO/c1-4-10-17(11-5-1)16-22-21-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-21H,16H2 |
| InChIKey | NOHXHPOFSBCOCL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 270 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-Benzoxybenzhydrylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Benzoxybenzhydrylamine?
The IUPAC name of N-Benzoxybenzhydrylamine (CID 15025165) is 1,1-diphenyl-N-phenylmethoxymethanamine.
What is the SMILES notation for N-Benzoxybenzhydrylamine?
The canonical SMILES for N-Benzoxybenzhydrylamine is C1=CC=C(C=C1)CONC(C2=CC=CC=C2)C3=CC=CC=C3.
What is the InChIKey of N-Benzoxybenzhydrylamine?
The InChIKey is NOHXHPOFSBCOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO/c1-4-10-17(11-5-1)16-22-21-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-21H,16H2.
What are the key properties of N-Benzoxybenzhydrylamine?
N-Benzoxybenzhydrylamine has a molecular weight of 289.40 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-Benzoxybenzhydrylamine is sourced from PubChem (CID 15025165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).