C21H32O5 — CID 10690153
[5-[(E,4S)-2,4-dimethyl-3-oxohex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10690153) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [5-[(E,4S)-2,4-dimethyl-3-oxohex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [5-[(E,4S)-2,4-dimethyl-3-oxohex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10690153 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [5-[(E,4S)-2,4-dimethyl-3-oxohex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCC1=C(COC(=O)C(C)(C)C)C(=O)C(C)(/C=C(\C)C(=O)[C@@H](C)CC)O1 |
| InChI | InChI=1S/C21H32O5/c1-9-13(3)17(22)14(4)11-21(8)18(23)15(16(10-2)26-21)12-25-19(24)20(5,6)7/h11,13H,9-10,12H2,1-8H3/b14-11+/t13-,21?/m0/s1 |
| InChIKey | FWFFEDBHOYONEC-VWRWSWCISA-N |
| XLogP | 4.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|