C20H18N2O5 — CID 10690247
2-[(Z)-4-[[4-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]but-2-enyl]isoindole-1,3-dione (PubChem CID 10690247) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-[(Z)-4-[[4-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]but-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-4-[[4-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]but-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10690247 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[(Z)-4-[[4-(1,3-dioxolan-2-yl)-2-pyridinyl]oxy]but-2-enyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C/C=C\COc1cc(C2OCCO2)ccn1 |
| InChI | InChI=1S/C20H18N2O5/c23-18-15-5-1-2-6-16(15)19(24)22(18)9-3-4-10-25-17-13-14(7-8-21-17)20-26-11-12-27-20/h1-8,13,20H,9-12H2/b4-3- |
| InChIKey | NZGYLELIHSEQQN-ARJAWSKDSA-N |
| XLogP | 2.36 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|