C18H25NO2 — CID 106903079
1-(3-ethylcyclohexyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid (PubChem CID 106903079) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid.
| Compound Name | 1-(3-ethylcyclohexyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 106903079 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-3,4-dihydro-2H-quinoline-3-carboxylic acid |
| SMILES | CCC1CCCC(N2CC(C(=O)O)Cc3ccccc32)C1 |
| InChI | InChI=1S/C18H25NO2/c1-2-13-6-5-8-16(10-13)19-12-15(18(20)21)11-14-7-3-4-9-17(14)19/h3-4,7,9,13,15-16H,2,5-6,8,10-12H2,1H3,(H,20,21) |
| InChIKey | YULHJANKXBNBEJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |