C24H16O4 — CID 10690369
18,19-dimethoxypentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22),18,20-decaene-10,11-dione (PubChem CID 10690369) has the molecular formula C24H16O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 18,19-dimethoxypentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22),18,20-decaene-10,11-dione.
| Compound Name | 18,19-dimethoxypentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22),18,20-decaene-10,11-dione |
|---|---|
| PubChem CID | 10690369 |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 18,19-dimethoxypentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17(22),18,20-decaene-10,11-dione |
| SMILES | COc1ccc2c(ccc3cc4c(cc32)-c2ccccc2C(=O)C4=O)c1OC |
| InChI | InChI=1S/C24H16O4/c1-27-21-10-9-15-17(24(21)28-2)8-7-13-11-20-19(12-18(13)15)14-5-3-4-6-16(14)22(25)23(20)26/h3-12H,1-2H3 |
| InChIKey | IBGWFSBMDVOMKD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|