C14H19NO4S — CID 106903841
6-[(3-methylcyclohexyl)sulfonylmethyl]pyridine-2-carboxylic acid (PubChem CID 106903841) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 6-[(3-methylcyclohexyl)sulfonylmethyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(3-methylcyclohexyl)sulfonylmethyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106903841 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 6-[(3-methylcyclohexyl)sulfonylmethyl]pyridine-2-carboxylic acid |
| SMILES | CC1CCCC(S(=O)(=O)Cc2cccc(C(=O)O)n2)C1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-4-2-6-12(8-10)20(18,19)9-11-5-3-7-13(15-11)14(16)17/h3,5,7,10,12H,2,4,6,8-9H2,1H3,(H,16,17) |
| InChIKey | JMCXZTUJHSKAFA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |