C15H24F3N3 — CID 106906020
N-[[6-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-2-pyridinyl]methyl]propan-1-amine (PubChem CID 106906020) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[[6-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106906020 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[[6-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(CN(CC(F)(F)F)C(C)C)n1 |
| InChI | InChI=1S/C15H24F3N3/c1-4-8-19-9-13-6-5-7-14(20-13)10-21(12(2)3)11-15(16,17)18/h5-7,12,19H,4,8-11H2,1-3H3 |
| InChIKey | XYPVPFZMNFTOBJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|