C13H19F3N2O — CID 106908474
N-[[6-(1,1,1-trifluoropropan-2-yloxymethyl)-2-pyridinyl]methyl]propan-1-amine (PubChem CID 106908474) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-[[6-(1,1,1-trifluoropropan-2-yloxymethyl)-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(1,1,1-trifluoropropan-2-yloxymethyl)-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106908474 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[[6-(1,1,1-trifluoropropan-2-yloxymethyl)-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(COC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H19F3N2O/c1-3-7-17-8-11-5-4-6-12(18-11)9-19-10(2)13(14,15)16/h4-6,10,17H,3,7-9H2,1-2H3 |
| InChIKey | HHAPVWXDQIFVAZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|