C18H24N2O — CID 106907958
N-[[6-[(2,3-dimethylphenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine (PubChem CID 106907958) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[[6-[(2,3-dimethylphenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(2,3-dimethylphenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106907958 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[[6-[(2,3-dimethylphenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(COc2cccc(C)c2C)n1 |
| InChI | InChI=1S/C18H24N2O/c1-4-11-19-12-16-8-6-9-17(20-16)13-21-18-10-5-7-14(2)15(18)3/h5-10,19H,4,11-13H2,1-3H3 |
| InChIKey | XMXLQTWIPNCAMC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|