C16H18Cl2N2O — CID 106908243
N-[[6-[(3,4-dichlorophenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine (PubChem CID 106908243) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is N-[[6-[(3,4-dichlorophenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(3,4-dichlorophenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106908243 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[[6-[(3,4-dichlorophenoxy)methyl]-2-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(COc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H18Cl2N2O/c1-2-8-19-10-12-4-3-5-13(20-12)11-21-14-6-7-15(17)16(18)9-14/h3-7,9,19H,2,8,10-11H2,1H3 |
| InChIKey | IKCLPLXOLSKKOZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|