C16H17NO3 — CID 106913703
3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)benzaldehyde (PubChem CID 106913703) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)benzaldehyde.
| Compound Name | 3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 106913703 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)benzaldehyde |
| SMILES | O=Cc1cccc(N2C(=O)CC3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C16H17NO3/c18-11-12-5-4-6-13(9-12)17-14(19)10-16(15(17)20)7-2-1-3-8-16/h4-6,9,11H,1-3,7-8,10H2 |
| InChIKey | VULDBDLMTUZOKE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|