C16H13N3O2 — CID 107796089
4-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)benzene-1,2-dicarbonitrile (PubChem CID 107796089) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107796089 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)CC3(CCCC3)C2=O)cc1C#N |
| InChI | InChI=1S/C16H13N3O2/c17-9-11-3-4-13(7-12(11)10-18)19-14(20)8-16(15(19)21)5-1-2-6-16/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | UJUUHODBZBUGSW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|