About 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide
3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide (PubChem CID 106914616) has the molecular formula C13H25N5O2
and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide |
| PubChem CID | 106914616 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)CC(O)Cn1nc(C)c(N)c1C |
| InChI | InChI=1S/C13H25N5O2/c1-9-13(14)10(2)18(16-9)8-11(19)7-17(4)6-5-12(20)15-3/h11,19H,5-8,14H2,1-4H3,(H,15,20) |
| InChIKey | XVUPWBIPNXBDQM-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide?
The IUPAC name of 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide (CID 106914616) is 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide.
What is the SMILES notation for 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide?
The canonical SMILES for 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide is CNC(=O)CCN(C)CC(O)Cn1nc(C)c(N)c1C.
What is the InChIKey of 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide?
The InChIKey is XVUPWBIPNXBDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5O2/c1-9-13(14)10(2)18(16-9)8-11(19)7-17(4)6-5-12(20)15-3/h11,19H,5-8,14H2,1-4H3,(H,15,20).
What are the key properties of 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide?
3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide has a molecular weight of 283.38 g/mol, XLogP of -0.49, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-methylamino]-N-methylpropanamide is sourced from PubChem (CID 106914616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).