About 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol
1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol (PubChem CID 79385295) has the molecular formula C14H28N4O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol |
| PubChem CID | 79385295 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(O)Cn1nc(C)c(N)c1C)CC(C)(C)O |
| InChI | InChI=1S/C14H28N4O2/c1-6-17(9-14(4,5)20)7-12(19)8-18-11(3)13(15)10(2)16-18/h12,19-20H,6-9,15H2,1-5H3 |
| InChIKey | PQBUULXLQVZWHS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol?
The IUPAC name of 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol (CID 79385295) is 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol?
The canonical SMILES for 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol is CCN(CC(O)Cn1nc(C)c(N)c1C)CC(C)(C)O.
What is the InChIKey of 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol?
The InChIKey is PQBUULXLQVZWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O2/c1-6-17(9-14(4,5)20)7-12(19)8-18-11(3)13(15)10(2)16-18/h12,19-20H,6-9,15H2,1-5H3.
What are the key properties of 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol?
1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol has a molecular weight of 284.40 g/mol, XLogP of 0.54, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(4-amino-3,5-dimethylpyrazol-1-yl)-2-hydroxypropyl]-ethylamino]-2-methylpropan-2-ol is sourced from PubChem (CID 79385295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).