C21H14F3NO3 — CID 10691467
methyl (2E)-2-methoxyimino-2-[2-[4-[2-(trifluoromethyl)phenyl]buta-1,3-diynyl]phenyl]acetate (PubChem CID 10691467) has the molecular formula C21H14F3NO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[2-[4-[2-(trifluoromethyl)phenyl]buta-1,3-diynyl]phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[2-[4-[2-(trifluoromethyl)phenyl]buta-1,3-diynyl]phenyl]acetate |
|---|---|
| PubChem CID | 10691467 |
| Molecular Formula | C21H14F3NO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[2-[4-[2-(trifluoromethyl)phenyl]buta-1,3-diynyl]phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1C#CC#Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H14F3NO3/c1-27-20(26)19(25-28-2)17-13-7-5-10-15(17)9-3-4-11-16-12-6-8-14-18(16)21(22,23)24/h5-8,10,12-14H,1-2H3/b25-19+ |
| InChIKey | SOYLFBFGNFMIGC-NCELDCMTSA-N |
| XLogP | 3.63 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|