C24H23N3O2 — CID 10691487
1-[(S)-[(2R)-2-(2,5-dimethylphenyl)oxiran-2-yl]-(3-methoxyphenyl)methyl]benzotriazole (PubChem CID 10691487) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-[(S)-[(2R)-2-(2,5-dimethylphenyl)oxiran-2-yl]-(3-methoxyphenyl)methyl]benzotriazole.
| Compound Name | 1-[(S)-[(2R)-2-(2,5-dimethylphenyl)oxiran-2-yl]-(3-methoxyphenyl)methyl]benzotriazole |
|---|---|
| PubChem CID | 10691487 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[(S)-[(2R)-2-(2,5-dimethylphenyl)oxiran-2-yl]-(3-methoxyphenyl)methyl]benzotriazole |
| SMILES | COc1cccc([C@H](n2nnc3ccccc32)[C@]2(c3cc(C)ccc3C)CO2)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-16-11-12-17(2)20(13-16)24(15-29-24)23(18-7-6-8-19(14-18)28-3)27-22-10-5-4-9-21(22)25-26-27/h4-14,23H,15H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | CLMOXXKJUMRMIP-BJKOFHAPSA-N |
| XLogP | 4.57 |
| TPSA | 52.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|