C8H19N3O3S — CID 106915137
3-[3-aminopropylsulfonyl(methyl)amino]-N-methylpropanamide (PubChem CID 106915137) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-[3-aminopropylsulfonyl(methyl)amino]-N-methylpropanamide.
| Compound Name | 3-[3-aminopropylsulfonyl(methyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106915137 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-[3-aminopropylsulfonyl(methyl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)S(=O)(=O)CCCN |
| InChI | InChI=1S/C8H19N3O3S/c1-10-8(12)4-6-11(2)15(13,14)7-3-5-9/h3-7,9H2,1-2H3,(H,10,12) |
| InChIKey | FQMTXVDMVRNNCO-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |