C10H14Br2O6 — CID 10691777
dimethyl 2,2-dibromo-3-(2-methoxy-2-oxoethyl)pentanedioate (PubChem CID 10691777) has the molecular formula C10H14Br2O6 and a molecular weight of 390.02 g/mol. Its IUPAC name is dimethyl 2,2-dibromo-3-(2-methoxy-2-oxoethyl)pentanedioate.
| Compound Name | dimethyl 2,2-dibromo-3-(2-methoxy-2-oxoethyl)pentanedioate |
|---|---|
| PubChem CID | 10691777 |
| Molecular Formula | C10H14Br2O6 |
| Molecular Weight | 390.02 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | dimethyl 2,2-dibromo-3-(2-methoxy-2-oxoethyl)pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)C(Br)(Br)C(=O)OC |
| InChI | InChI=1S/C10H14Br2O6/c1-16-7(13)4-6(5-8(14)17-2)10(11,12)9(15)18-3/h6H,4-5H2,1-3H3 |
| InChIKey | DHDTZSJETPKFGJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.02 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|