C13H18O7 — CID 100929878
trimethyl 2-but-3-ynyl-1-hydroxypropane-1,1,3-tricarboxylate (PubChem CID 100929878) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is trimethyl 2-but-3-ynyl-1-hydroxypropane-1,1,3-tricarboxylate.
| Compound Name | trimethyl 2-but-3-ynyl-1-hydroxypropane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 100929878 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | trimethyl 2-but-3-ynyl-1-hydroxypropane-1,1,3-tricarboxylate |
| SMILES | C#CCCC(CC(=O)OC)C(O)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H18O7/c1-5-6-7-9(8-10(14)18-2)13(17,11(15)19-3)12(16)20-4/h1,9,17H,6-8H2,2-4H3 |
| InChIKey | YAPZDUNNBWKBTR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|