About 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate
4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate (PubChem CID 10751006) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate.
Molecular Properties
| Compound Name | 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate |
| PubChem CID | 10751006 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate |
| SMILES | C#CCOC(=O)C(CC(=O)OC)C(C)=O |
| InChI | InChI=1S/C10H12O5/c1-4-5-15-10(13)8(7(2)11)6-9(12)14-3/h1,8H,5-6H2,2-3H3 |
| InChIKey | JBBTWIVDENVXHX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate?
The IUPAC name of 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate (CID 10751006) is 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate.
What is the SMILES notation for 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate?
The canonical SMILES for 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate is C#CCOC(=O)C(CC(=O)OC)C(C)=O.
What is the InChIKey of 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate?
The InChIKey is JBBTWIVDENVXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-4-5-15-10(13)8(7(2)11)6-9(12)14-3/h1,8H,5-6H2,2-3H3.
What are the key properties of 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate?
4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate has a molecular weight of 212.20 g/mol, XLogP of -0.07, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-methyl 1-O-prop-2-ynyl 2-acetylbutanedioate is sourced from PubChem (CID 10751006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).