C18H26O4 — CID 122206548
3-(2,2-dimethylpropanoyloxy)octa-1,7-diyn-4-yl 2,2-dimethylpropanoate (PubChem CID 122206548) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyloxy)octa-1,7-diyn-4-yl 2,2-dimethylpropanoate.
| Compound Name | 3-(2,2-dimethylpropanoyloxy)octa-1,7-diyn-4-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122206548 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-(2,2-dimethylpropanoyloxy)octa-1,7-diyn-4-yl 2,2-dimethylpropanoate |
| SMILES | C#CCCC(OC(=O)C(C)(C)C)C(C#C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H26O4/c1-9-11-12-14(22-16(20)18(6,7)8)13(10-2)21-15(19)17(3,4)5/h1-2,13-14H,11-12H2,3-8H3 |
| InChIKey | ZBIZMAONPOFZGR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|