C10H18N4 — CID 106918163
N,N',2-trimethyl-N'-pyrimidin-4-ylpropane-1,3-diamine (PubChem CID 106918163) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N,N',2-trimethyl-N'-pyrimidin-4-ylpropane-1,3-diamine.
| Compound Name | N,N',2-trimethyl-N'-pyrimidin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106918163 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N,N',2-trimethyl-N'-pyrimidin-4-ylpropane-1,3-diamine |
| SMILES | CNCC(C)CN(C)c1ccncn1 |
| InChI | InChI=1S/C10H18N4/c1-9(6-11-2)7-14(3)10-4-5-12-8-13-10/h4-5,8-9,11H,6-7H2,1-3H3 |
| InChIKey | MBUMLZLHHFZOJC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |