C9H14N4O — CID 83618247
2-methyl-3-(methylamino)-N-pyrimidin-4-ylpropanamide (PubChem CID 83618247) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-pyrimidin-4-ylpropanamide.
| Compound Name | 2-methyl-3-(methylamino)-N-pyrimidin-4-ylpropanamide |
|---|---|
| PubChem CID | 83618247 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-pyrimidin-4-ylpropanamide |
| SMILES | CNCC(C)C(=O)Nc1ccncn1 |
| InChI | InChI=1S/C9H14N4O/c1-7(5-10-2)9(14)13-8-3-4-11-6-12-8/h3-4,6-7,10H,5H2,1-2H3,(H,11,12,13,14) |
| InChIKey | OLXVETAMDUZGFU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |