About 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole
2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole (PubChem CID 106924341) has the molecular formula C13H13NOS2
and a molecular weight of 263.39 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole |
| PubChem CID | 106924341 |
| Molecular Formula | C13H13NOS2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole |
| SMILES | Cc1coc(SCC2Cc3ccccc3S2)n1 |
| InChI | InChI=1S/C13H13NOS2/c1-9-7-15-13(14-9)16-8-11-6-10-4-2-3-5-12(10)17-11/h2-5,7,11H,6,8H2,1H3 |
| InChIKey | AQYDEFAIDNNJQH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole?
The IUPAC name of 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole (CID 106924341) is 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole.
What is the SMILES notation for 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole?
The canonical SMILES for 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole is Cc1coc(SCC2Cc3ccccc3S2)n1.
What is the InChIKey of 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole?
The InChIKey is AQYDEFAIDNNJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NOS2/c1-9-7-15-13(14-9)16-8-11-6-10-4-2-3-5-12(10)17-11/h2-5,7,11H,6,8H2,1H3.
What are the key properties of 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole?
2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole has a molecular weight of 263.39 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-methyl-1,3-oxazole is sourced from PubChem (CID 106924341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).