C16H17NS2 — CID 79222595
2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-6-methylaniline (PubChem CID 79222595) has the molecular formula C16H17NS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-6-methylaniline.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-6-methylaniline |
|---|---|
| PubChem CID | 79222595 |
| Molecular Formula | C16H17NS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-6-methylaniline |
| SMILES | Cc1cccc(SCC2Cc3ccccc3S2)c1N |
| InChI | InChI=1S/C16H17NS2/c1-11-5-4-8-15(16(11)17)18-10-13-9-12-6-2-3-7-14(12)19-13/h2-8,13H,9-10,17H2,1H3 |
| InChIKey | UUJFNKZQJRSYHE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|