C12H17NS — CID 79146458
2-(cyclobutylmethylsulfanyl)-6-methylaniline (PubChem CID 79146458) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-(cyclobutylmethylsulfanyl)-6-methylaniline.
| Compound Name | 2-(cyclobutylmethylsulfanyl)-6-methylaniline |
|---|---|
| PubChem CID | 79146458 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-(cyclobutylmethylsulfanyl)-6-methylaniline |
| SMILES | Cc1cccc(SCC2CCC2)c1N |
| InChI | InChI=1S/C12H17NS/c1-9-4-2-7-11(12(9)13)14-8-10-5-3-6-10/h2,4,7,10H,3,5-6,8,13H2,1H3 |
| InChIKey | URKOMJKTHYOHKG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|