C17H19NOS — CID 79146573
2-methyl-6-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline (PubChem CID 79146573) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-methyl-6-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline.
| Compound Name | 2-methyl-6-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79146573 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-methyl-6-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline |
| SMILES | Cc1ccc2c(c1)CC(CSc1cccc(C)c1N)O2 |
| InChI | InChI=1S/C17H19NOS/c1-11-6-7-15-13(8-11)9-14(19-15)10-20-16-5-3-4-12(2)17(16)18/h3-8,14H,9-10,18H2,1-2H3 |
| InChIKey | HFBFNMQMQPLFOX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|