C16H17NO2S — CID 81181359
3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfinyl]aniline (PubChem CID 81181359) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfinyl]aniline.
| Compound Name | 3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 81181359 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfinyl]aniline |
| SMILES | Cc1ccc2c(c1)CC(CS(=O)c1cccc(N)c1)O2 |
| InChI | InChI=1S/C16H17NO2S/c1-11-5-6-16-12(7-11)8-14(19-16)10-20(18)15-4-2-3-13(17)9-15/h2-7,9,14H,8,10,17H2,1H3 |
| InChIKey | LNLXNDGZPUHDTB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|