C16H16ClNO2 — CID 66362667
4-chloro-3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline (PubChem CID 66362667) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 4-chloro-3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline.
| Compound Name | 4-chloro-3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 66362667 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-chloro-3-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline |
| SMILES | Cc1ccc2c(c1)CC(COc1cc(N)ccc1Cl)O2 |
| InChI | InChI=1S/C16H16ClNO2/c1-10-2-5-15-11(6-10)7-13(20-15)9-19-16-8-12(18)3-4-14(16)17/h2-6,8,13H,7,9,18H2,1H3 |
| InChIKey | OLJHDXUINQDMFG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|