C16H16ClNOS — CID 66360029
3-chloro-4-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline (PubChem CID 66360029) has the molecular formula C16H16ClNOS and a molecular weight of 305.83 g/mol. Its IUPAC name is 3-chloro-4-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline.
| Compound Name | 3-chloro-4-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 66360029 |
| Molecular Formula | C16H16ClNOS |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-chloro-4-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]aniline |
| SMILES | Cc1ccc2c(c1)CC(CSc1ccc(N)cc1Cl)O2 |
| InChI | InChI=1S/C16H16ClNOS/c1-10-2-4-15-11(6-10)7-13(19-15)9-20-16-5-3-12(18)8-14(16)17/h2-6,8,13H,7,9,18H2,1H3 |
| InChIKey | SLCWXAKRFQOXFL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|