C16H16FNOS — CID 66362969
4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylaniline (PubChem CID 66362969) has the molecular formula C16H16FNOS and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylaniline.
| Compound Name | 4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylaniline |
|---|---|
| PubChem CID | 66362969 |
| Molecular Formula | C16H16FNOS |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylaniline |
| SMILES | Cc1cc(N)ccc1SCC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C16H16FNOS/c1-10-6-13(18)3-5-16(10)20-9-14-8-11-7-12(17)2-4-15(11)19-14/h2-7,14H,8-9,18H2,1H3 |
| InChIKey | ZFICVLGDPZEFEF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|