C17H19NOS2 — CID 79511747
2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-ethoxyaniline (PubChem CID 79511747) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-ethoxyaniline.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-ethoxyaniline |
|---|---|
| PubChem CID | 79511747 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfanyl)-4-ethoxyaniline |
| SMILES | CCOc1ccc(N)c(SCC2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C17H19NOS2/c1-2-19-13-7-8-15(18)17(10-13)20-11-14-9-12-5-3-4-6-16(12)21-14/h3-8,10,14H,2,9,11,18H2,1H3 |
| InChIKey | PRFZALOBWNASGD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|