C17H19NOS — CID 79222550
N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-3-ethoxyaniline (PubChem CID 79222550) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-3-ethoxyaniline.
| Compound Name | N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-3-ethoxyaniline |
|---|---|
| PubChem CID | 79222550 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-3-ethoxyaniline |
| SMILES | CCOc1cccc(NCC2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C17H19NOS/c1-2-19-15-8-5-7-14(11-15)18-12-16-10-13-6-3-4-9-17(13)20-16/h3-9,11,16,18H,2,10,12H2,1H3 |
| InChIKey | ASHOATSFNJBRIN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |