C15H20N2OS — CID 106926798
N-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]phenyl]methyl]propan-1-amine (PubChem CID 106926798) has the molecular formula C15H20N2OS and a molecular weight of 276.41 g/mol. Its IUPAC name is N-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106926798 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccccc1Sc1nc(C)c(C)o1 |
| InChI | InChI=1S/C15H20N2OS/c1-4-9-16-10-13-7-5-6-8-14(13)19-15-17-11(2)12(3)18-15/h5-8,16H,4,9-10H2,1-3H3 |
| InChIKey | HMTPVJGGBNPEIQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|