C22H38N2O5 — CID 10692937
3-(1,3-benzodioxol-5-ylmethyl)-4-[3-[3-(diethylamino)propylamino]-2-hydroxypropoxy]butan-1-ol (PubChem CID 10692937) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-4-[3-[3-(diethylamino)propylamino]-2-hydroxypropoxy]butan-1-ol.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-[3-[3-(diethylamino)propylamino]-2-hydroxypropoxy]butan-1-ol |
|---|---|
| PubChem CID | 10692937 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-[3-[3-(diethylamino)propylamino]-2-hydroxypropoxy]butan-1-ol |
| SMILES | CCN(CC)CCCNCC(O)COCC(CCO)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H38N2O5/c1-3-24(4-2)10-5-9-23-14-20(26)16-27-15-19(8-11-25)12-18-6-7-21-22(13-18)29-17-28-21/h6-7,13,19-20,23,25-26H,3-5,8-12,14-17H2,1-2H3 |
| InChIKey | VCPWAPXYXJOOLF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|