C13H20O3 — CID 106930023
2-(cyclopropylmethoxymethyl)bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 106930023) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(cyclopropylmethoxymethyl)bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 2-(cyclopropylmethoxymethyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 106930023 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-(cyclopropylmethoxymethyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1(COCC2CC2)CC2CCC1C2 |
| InChI | InChI=1S/C13H20O3/c14-12(15)13(8-16-7-9-1-2-9)6-10-3-4-11(13)5-10/h9-11H,1-8H2,(H,14,15) |
| InChIKey | SJFVNMBAQVMLDC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |