C17H31NO — CID 106930723
N-[[2-(cyclopropylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2-methylpropan-1-amine (PubChem CID 106930723) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N-[[2-(cyclopropylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[2-(cyclopropylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 106930723 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N-[[2-(cyclopropylmethoxymethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1(COCC2CC2)CC2CCC1C2 |
| InChI | InChI=1S/C17H31NO/c1-13(2)9-18-11-17(12-19-10-14-3-4-14)8-15-5-6-16(17)7-15/h13-16,18H,3-12H2,1-2H3 |
| InChIKey | BYNJALQLZABSTM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |