C11H15BrN2O — CID 106934733
2-bromo-N,3-dimethyl-N-pyridin-4-ylbutanamide (PubChem CID 106934733) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 2-bromo-N,3-dimethyl-N-pyridin-4-ylbutanamide.
| Compound Name | 2-bromo-N,3-dimethyl-N-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 106934733 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-bromo-N,3-dimethyl-N-pyridin-4-ylbutanamide |
| SMILES | CC(C)C(Br)C(=O)N(C)c1ccncc1 |
| InChI | InChI=1S/C11H15BrN2O/c1-8(2)10(12)11(15)14(3)9-4-6-13-7-5-9/h4-8,10H,1-3H3 |
| InChIKey | NJTZFDZCVVWBQT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|