C8H11ClN2O2 — CID 172753454
carbonochloridic acid;N,N-dimethylpyridin-4-amine (PubChem CID 172753454) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is carbonochloridic acid;N,N-dimethylpyridin-4-amine.
| Compound Name | carbonochloridic acid;N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 172753454 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | carbonochloridic acid;N,N-dimethylpyridin-4-amine |
| SMILES | CN(C)c1ccncc1.O=C(O)Cl |
| InChI | InChI=1S/C7H10N2.CHClO2/c1-9(2)7-3-5-8-6-4-7;2-1(3)4/h3-6H,1-2H3;(H,3,4) |
| InChIKey | KRTSAIGZBQJHPY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|