C7H11LiN2O — CID 174914031
lithium;N,N-dimethylpyridin-4-amine;hydroxide (PubChem CID 174914031) has the molecular formula C7H11LiN2O and a molecular weight of 146.12 g/mol. Its IUPAC name is lithium;N,N-dimethylpyridin-4-amine;hydroxide.
| Compound Name | lithium;N,N-dimethylpyridin-4-amine;hydroxide |
|---|---|
| PubChem CID | 174914031 |
| Molecular Formula | C7H11LiN2O |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.10 |
| IUPAC Name | lithium;N,N-dimethylpyridin-4-amine;hydroxide |
| SMILES | CN(C)c1ccncc1.[Li+].[OH-] |
| InChI | InChI=1S/C7H10N2.Li.H2O/c1-9(2)7-3-5-8-6-4-7;;/h3-6H,1-2H3;;1H2/q;+1;/p-1 |
| InChIKey | QVMKYZFGDRLQNE-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 46.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |