About lithium;N,N-dimethylpyridin-4-amine;hydroxide
lithium;N,N-dimethylpyridin-4-amine;hydroxide (PubChem CID 174914031) has the molecular formula C7H11LiN2O
and a molecular weight of 146.12 g/mol. Its IUPAC name is lithium;N,N-dimethylpyridin-4-amine;hydroxide.
Molecular Properties
| Compound Name | lithium;N,N-dimethylpyridin-4-amine;hydroxide |
| PubChem CID | 174914031 |
| Molecular Formula | C7H11LiN2O |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.10 |
| IUPAC Name | lithium;N,N-dimethylpyridin-4-amine;hydroxide |
| SMILES | CN(C)c1ccncc1.[Li+].[OH-] |
| InChI | InChI=1S/C7H10N2.Li.H2O/c1-9(2)7-3-5-8-6-4-7;;/h3-6H,1-2H3;;1H2/q;+1;/p-1 |
| InChIKey | QVMKYZFGDRLQNE-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 46.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;N,N-dimethylpyridin-4-amine;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N,N-dimethylpyridin-4-amine;hydroxide?
The IUPAC name of lithium;N,N-dimethylpyridin-4-amine;hydroxide (CID 174914031) is lithium;N,N-dimethylpyridin-4-amine;hydroxide.
What is the SMILES notation for lithium;N,N-dimethylpyridin-4-amine;hydroxide?
The canonical SMILES for lithium;N,N-dimethylpyridin-4-amine;hydroxide is CN(C)c1ccncc1.[Li+].[OH-].
What is the InChIKey of lithium;N,N-dimethylpyridin-4-amine;hydroxide?
The InChIKey is QVMKYZFGDRLQNE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10N2.Li.H2O/c1-9(2)7-3-5-8-6-4-7;;/h3-6H,1-2H3;;1H2/q;+1;/p-1.
What are the key properties of lithium;N,N-dimethylpyridin-4-amine;hydroxide?
lithium;N,N-dimethylpyridin-4-amine;hydroxide has a molecular weight of 146.12 g/mol, XLogP of -2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N,N-dimethylpyridin-4-amine;hydroxide is sourced from PubChem (CID 174914031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).