C7H10N2 — CID 10942410
2-deuterio-N,N-dimethylpyridin-4-amine (PubChem CID 10942410) has the molecular formula C7H10N2 and a molecular weight of 123.18 g/mol. Its IUPAC name is 2-deuterio-N,N-dimethylpyridin-4-amine.
| Compound Name | 2-deuterio-N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 10942410 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | 2-deuterio-N,N-dimethylpyridin-4-amine |
| SMILES | [2H]c1cc(N(C)C)ccn1 |
| InChI | InChI=1S/C7H10N2/c1-9(2)7-3-5-8-6-4-7/h3-6H,1-2H3/i5D |
| InChIKey | VHYFNPMBLIVWCW-UICOGKGYSA-N |
| XLogP | 1.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |