About N,N-dimethylpyridin-4-amine;terbium
N,N-dimethylpyridin-4-amine;terbium (PubChem CID 21052224) has the molecular formula C7H10N2Tb
and a molecular weight of 281.10 g/mol. Its IUPAC name is N,N-dimethylpyridin-4-amine;terbium.
Molecular Properties
| Compound Name | N,N-dimethylpyridin-4-amine;terbium |
| PubChem CID | 21052224 |
| Molecular Formula | C7H10N2Tb |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | N,N-dimethylpyridin-4-amine;terbium |
| SMILES | CN(C)c1ccncc1.[Tb] |
| InChI | InChI=1S/C7H10N2.Tb/c1-9(2)7-3-5-8-6-4-7;/h3-6H,1-2H3; |
| InChIKey | VITXMRZNIIWACV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylpyridin-4-amine;terbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpyridin-4-amine;terbium?
The IUPAC name of N,N-dimethylpyridin-4-amine;terbium (CID 21052224) is N,N-dimethylpyridin-4-amine;terbium.
What is the SMILES notation for N,N-dimethylpyridin-4-amine;terbium?
The canonical SMILES for N,N-dimethylpyridin-4-amine;terbium is CN(C)c1ccncc1.[Tb].
What is the InChIKey of N,N-dimethylpyridin-4-amine;terbium?
The InChIKey is VITXMRZNIIWACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.Tb/c1-9(2)7-3-5-8-6-4-7;/h3-6H,1-2H3;.
What are the key properties of N,N-dimethylpyridin-4-amine;terbium?
N,N-dimethylpyridin-4-amine;terbium has a molecular weight of 281.10 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyridin-4-amine;terbium is sourced from PubChem (CID 21052224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).