C13H20N2O5 — CID 159113501
tert-butyl carboxy carbonate;N,N-dimethylpyridin-4-amine (PubChem CID 159113501) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is tert-butyl carboxy carbonate;N,N-dimethylpyridin-4-amine.
| Compound Name | tert-butyl carboxy carbonate;N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 159113501 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | tert-butyl carboxy carbonate;N,N-dimethylpyridin-4-amine |
| SMILES | CC(C)(C)OC(=O)OC(=O)O.CN(C)c1ccncc1 |
| InChI | InChI=1S/C7H10N2.C6H10O5/c1-9(2)7-3-5-8-6-4-7;1-6(2,3)11-5(9)10-4(7)8/h3-6H,1-2H3;1-3H3,(H,7,8) |
| InChIKey | KEUFOVFUDBYNSY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|