C12H16N2O3 — CID 69108647
tert-butyl N-acetyl-N-pyridin-4-ylcarbamate (PubChem CID 69108647) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is tert-butyl N-acetyl-N-pyridin-4-ylcarbamate.
| Compound Name | tert-butyl N-acetyl-N-pyridin-4-ylcarbamate |
|---|---|
| PubChem CID | 69108647 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | tert-butyl N-acetyl-N-pyridin-4-ylcarbamate |
| SMILES | CC(=O)N(C(=O)OC(C)(C)C)c1ccncc1 |
| InChI | InChI=1S/C12H16N2O3/c1-9(15)14(10-5-7-13-8-6-10)11(16)17-12(2,3)4/h5-8H,1-4H3 |
| InChIKey | GBNLAQIEVVPLIT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |