C17H24N2O4Zn — CID 139185110
zinc;N,N-dimethylpyridin-4-amine;bis((Z)-4-oxopent-2-en-2-olate) (PubChem CID 139185110) has the molecular formula C17H24N2O4Zn and a molecular weight of 385.78 g/mol. Its IUPAC name is zinc;N,N-dimethylpyridin-4-amine;bis((Z)-4-oxopent-2-en-2-olate).
| Compound Name | zinc;N,N-dimethylpyridin-4-amine;bis((Z)-4-oxopent-2-en-2-olate) |
|---|---|
| PubChem CID | 139185110 |
| Molecular Formula | C17H24N2O4Zn |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | zinc;N,N-dimethylpyridin-4-amine;bis((Z)-4-oxopent-2-en-2-olate) |
| SMILES | CC(=O)/C=C(/C)[O-].CC(=O)/C=C(/C)[O-].CN(C)c1ccncc1.[Zn+2] |
| InChI | InChI=1S/C7H10N2.2C5H8O2.Zn/c1-9(2)7-3-5-8-6-4-7;2*1-4(6)3-5(2)7;/h3-6H,1-2H3;2*3,6H,1-2H3;/q;;;+2/p-2/b;2*4-3-; |
| InChIKey | VPJCEMALVXKDLL-QDMRRLORSA-L |
| XLogP | 0.82 |
| TPSA | 96.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|